CAS 35969-75-6: 5-nitropyridine-2-carbaldehyde
Formula:C6H4N2O3
InChI:InChI=1/C6H4N2O3/c9-4-5-1-2-6(3-7-5)8(10)11/h1-4H
SMILES:c1cc(cnc1C=O)N(=O)=O
Synonyms:- 2-Pyridinecarboxaldehyde, 5-Nitro-
Sort by
Found 5 products.
5-Nitropyridine-2-carbaldehyde
CAS:Controlled ProductFormula:C6H4N2O3Color and Shape:NeatMolecular weight:152.1083-NITRO-6-PYRIDINECARBOXALDEHYDE
CAS:Formula:C6H4N2O3Purity:98%Color and Shape:SolidMolecular weight:152.10763-Nitro-6-pyridinecarboxaldehyde
CAS:3-Nitro-6-pyridinecarboxaldehydeFormula:C6H4N2O3Purity:98%Color and Shape: orange powderMolecular weight:152.11g/mol3-Nitro-6-pyridinecarboxaldehyde
CAS:3-Nitro-6-pyridinecarboxaldehyde is a colorless liquid that is soluble in water. It has a boiling point of 155 degrees Celsius, and it has a density of 1.03 grams per milliliter. This chemical reacts with metal ions to form nitro compounds. 3-Nitro-6-pyridinecarboxaldehyde has been used as an analytical reagent for the determination of benzenes and pyridines in organic solvents and gas chromatography calibration. The reactivity of this chemical is due to its pyridine ring, which can be used as a ligand or reagent.Formula:C6H4N2O3Purity:Min. 98%Color and Shape:PowderMolecular weight:152.11 g/mol
