
CAS 36145-03-6: 2,2'-bipyridine-3,3'-diol
Formula:C10H8N2O2
InChI:InChI=1/C10H8N2O2/c13-7-3-1-5-11-9(7)10-8(14)4-2-6-12-10/h1-6,13-14H
SMILES:c1cc(c(c2c(cccn2)O)nc1)O
Synonyms:- 3,3'-Dihydroxy-2,2'-Bipyridine
Sort by
Found 5 products.
2,2'-BIPYRIDINE-3,3'-DIOL
CAS:Formula:C10H8N2O2Purity:98%Color and Shape:SolidMolecular weight:188.182720000000022,2'-Bipyridine-3,3'-diol
CAS:Formula:C10H8N2O2Purity:>98.0%(GC)Color and Shape:Yellow - Green Solid FormMolecular weight:188.193,3'-Dihydroxy-2,2'-bipyridine
CAS:3,3'-Dihydroxy-2,2'-bipyridine is a water-soluble drug that has been shown to be cytotoxic. It binds to the hydroxyl group of hemoglobin and prevents it from binding with oxygen. 3,3'-Dihydroxy-2,2'-bipyridine also binds to the cell membrane and enters the cell where it forms a cavity with a chelate ring. The molecule has been shown to have high photophysical properties and can be used in biological studies.Formula:C10H8N2O2Purity:Min. 97.5 Area-%Color and Shape:White PowderMolecular weight:188.18 g/mol