
CAS 3623-23-2: 1-bromo-4-nitrosobenzene
Formula:C6H4BrNO
InChI:InChI=1/C6H4BrNO/c7-5-1-3-6(8-9)4-2-5/h1-4H
SMILES:c1cc(ccc1Br)N=O
Synonyms:- Benzene, 1-Bromo-4-Nitroso-
- 1-Bromo-4-nitrosobenzene
Sort by
Found 2 products.
1-Bromo-4-nitrosobenzene
CAS:Formula:C6H4BrNOPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:186.011-Bromo-4-nitrosobenzene
CAS:1-Bromo-4-nitrosobenzene is a chemical compound that has been shown to be a stable, metastable molecule. It can undergo nucleophilic attack on the carbonyl group by deuterium atoms. This reaction is dependent on kinetic and thermodynamic factors, such as activation energy and the concentration of the reactants. The FT-IR spectroscopy for this compound reveals that it consists of two heterodimers: one containing three nitroso groups and one bromine atom and another with two nitroso groups and one bromine atom. The rates of reaction for these monomers are different because they are not equivalent in terms of their chemical properties.Formula:C6H4BrNOPurity:Min. 95%Molecular weight:186.01 g/mol