
CAS 36304-40-2: 2-Chlorophenoxyacetic acid hydrazide
Formula:C8H9ClN2O2
InChI:InChI=1/C8H9ClN2O2/c9-6-3-1-2-4-7(6)13-5-8(12)11-10/h1-4H,5,10H2,(H,11,12)
SMILES:c1ccc(c(c1)Cl)OCC(=NN)O
Synonyms:- Asischem U30989
- Akos Bbb/158
- 2-Chlorophenoxyacetic acid hydrazide 98%
- 2-(2-Chlorophenoxy)Acetohydrazide
Sort by
Found 3 products.
2-(2-Chlorophenoxy)acetohydrazide
CAS:Formula:C8H9ClN2O2Color and Shape:SolidMolecular weight:200.62232-Chlorophenoxyacetic acid hydrazide
CAS:2-Chlorophenoxyacetic acid hydrazideFormula:C8H9ClN2O2Purity:98%Color and Shape: solidMolecular weight:200.62g/mol2-(2-Chlorophenoxy)acetohydrazide
CAS:2-(2-Chlorophenoxy)acetohydrazide is a medicament that contains ligustilide, which is extracted from Schizochytrium limacinum using hydrochloric acid. It is a polyunsaturated compound that exhibits antioxidant activity. The CO2 extract of 2-(2-Chlorophenoxy)acetohydrazide contains various bioactive compounds such as 4-hydroxy-3,5-dimethoxybenzoic acid, protocatechuic acid, stachyose, and fatty acids. These compounds contribute to its antioxidant and redox potential properties. Additionally, 2-(2-Chlorophenoxy)acetohydrazide has been found to have phenolic acid content and exhibit anaerobic ammonium oxidation activity. This medicament can be used in the formulation of various medicines for different therapeutic purposes.Formula:C8H9ClN2O2Purity:Min. 95%Molecular weight:200.62 g/mol