
CAS 3650-28-0: (+)-sativen
Formula:C15H24
InChI:InChI=1/C15H24/c1-9(2)11-7-8-15(4)10(3)12-5-6-13(15)14(11)12/h9,11-14H,3,5-8H2,1-2,4H3/t11-,12+,13+,14-,15+/m0/s1
Synonyms:- (+)-Sativene
Sort by
Found 2 products.
(+)-Sativene
CAS:(+)-Sativene is a sesquiterpene compound, which is a type of naturally occurring hydrocarbon. It is derived from various plant sources, including certain species of the Cannabis genus and other aromatic plants. As a member of the terpenoid family, (+)-Sativene is characterized by its distinctive hydrocarbon structure, contributing to its presence in essential oils and its role in natural plant fragrances. (+)-Sativene’s mode of action involves interaction with biological membranes and proteins, modulating various biochemical pathways. It exhibits potential biological activities, including roles in plant defense mechanisms and potential therapeutic properties, such as anti-inflammatory and antimicrobial effects. Its exact mechanisms remain a subject of ongoing research, as it may interact with cellular receptors and enzymes, influencing cellular responses. The uses and applications of (+)-Sativene are diverse, ranging from its role in ecological interactions within plant environments to its exploration in pharmaceutical and cosmetic research. In scientific studies, it is studied for its potential to contribute to the therapeutic efficacy of essential oils and as a natural product with prospects in drug discovery and development. Its multifaceted nature makes it a compound of interest in the fields of phytochemistry and pharmacology.Formula:C10H9ClN2Purity:Min. 95%Molecular weight:192.64 g/mol