CAS 3669-41-8: 2,4-Dihydroxyphenyl benzyl ketone
Formula:C14H12O3
InChI:InChI=1S/C14H12O3/c15-11-6-7-12(14(17)9-11)13(16)8-10-4-2-1-3-5-10/h1-7,9,15,17H,8H2
InChI key:InChIKey=VFQKAJVKZKHVPD-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=C1)(=O)C2=C(O)C=C(O)C=C2
Synonyms:- 2′,4′-Dihydroxy-2-phenylacetophenone
- 1-(2,4-Dihydroxyphenyl)-2-phenylethanone
- Acetophenone, 2′,4′-dihydroxy-2-phenyl-
- Ethanone, 1-(2,4-dihydroxyphenyl)-2-phenyl-
- 2,4-Dihydroxydeoxybenzoin
Sort by
Found 5 products.
1-(2,4-dihydroxyphenyl)-2-phenylethan-1-one
CAS:1-(2,4-dihydroxyphenyl)-2-phenylethan-1-onePurity:97%Molecular weight:228.24328g/molBenzyl 2,4-dihydroxyphenyl ketone
CAS:Benzyl 2,4-dihydroxyphenyl ketone (BDPK) is a chemical compound that has been used as a preservative in cosmetics and topical pharmaceuticals. BDPK inhibits the enzyme tyrosinase, which catalyzes the first step of melanin production. It also has anti-inflammatory properties and can inhibit the growth of bacteria such as Staphylococcus aureus. BDPK is synthesized by the Houben-Hoesch reaction between benzaldehyde and phenyldiazonium chloride. This process leads to an intermediate, which reacts with dimethylformamide to produce BDPK. The mechanism of this reaction is not well understood but it may involve tautomerization or intramolecular hydrogen transfer.Formula:C14H12O3Purity:Min. 95%Molecular weight:228.24 g/molRef: 3D-FB54143
Discontinued product1-(2,4-Dihydroxyphenyl)-2-phenylethanone
CAS:1-(2,4-Dihydroxyphenyl)-2-phenylethanonePurity:95%Molecular weight:228.24g/mol1-(2,4-Dihydroxyphenyl)-2-phenylethanone
CAS:Formula:C14H12O3Purity:98%Color and Shape:SolidMolecular weight:228.2433
