
CAS 36852-02-5: biphenyl-3,3'-dicarbonitrile
Formula:C14H8N2
InChI:InChI=1/C14H8N2/c15-9-11-3-1-5-13(7-11)14-6-2-4-12(8-14)10-16/h1-8H
SMILES:c1cc(cc(c1)c1cccc(c1)C#N)C#N
Synonyms:- [1,1'-Biphenyl]-3,3'-Dicarbonitrile
- Biphenyl-3,3'-dicarbonitrile
Sort by
Found 4 products.
BIPHENYL-3,3'-DICARBONITRILE
CAS:Formula:C14H8N2Purity:96%Color and Shape:SolidMolecular weight:204.22672000000003[1,1'-Biphenyl]-3,3'-dicarbonitrile
CAS:Biphenyl is a molecule that is composed of two benzene rings joined by a single bond. It has the chemical formula C12H10, and is sometimes called benzene hexacarbon. The molecule has six pi electrons in three different orbitals. This makes it highly reactive because it can easily form covalent bonds with other molecules. Biphenyl will react with most organic compounds, such as terephthalic acid, to form a variety of products. Some of these products are monomers and polymers which can be used for producing plastics or polyesters. Irradiation of biphenyl produces unidentified substances, which may be due to its ability to release cyanogen on exposure to acid solutions or radiation. Biphenyl has birefringence properties when observed through polarized light due to its molecular structure.Formula:C14H8N2Purity:Min. 95%Molecular weight:204.23 g/mol[1,1'-Biphenyl]-3,3'-dicarbonitrile
CAS:[1,1'-Biphenyl]-3,3'-dicarbonitrilePurity:95%Molecular weight:204.23g/mol