CAS 36889-15-3: Gentamicin B
Formula:C19H38N4O10
InChI:InChI=1S/C19H38N4O10/c1-19(29)5-30-17(13(28)16(19)23-2)32-14-6(21)3-7(22)15(12(14)27)33-18-11(26)10(25)9(24)8(4-20)31-18/h6-18,23-29H,3-5,20-22H2,1-2H3/t6-,7+,8-,9-,10+,11-,12-,13-,14+,15-,16-,17-,18-,19+/m1/s1
InChI key:InChIKey=RHRAMPXHWHSKQB-GGEUKFTFSA-N
SMILES:O([C@H]1[C@H](O)[C@@H](O[C@@H]2[C@H](O)[C@@H](NC)[C@@](C)(O)CO2)[C@H](N)C[C@@H]1N)[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O
Synonyms:- (1R,2R,3S,4R,6S)-4,6-diamino-3-{[3-deoxy-4-C-methyl-3-(methylamino)-β-L-arabinopyranosyl]oxy}-2-hydroxycyclohexyl 6-amino-6-deoxy-α-D-glucopyranoside
- 4,6-diamino-3-{[3-deoxy-4-C-methyl-3-(methylamino)pentopyranosyl]oxy}-2-hydroxycyclohexyl 6-amino-6-deoxyhexopyranoside
- <span class="text-smallcaps">D</smallcap>-Streptamine, O-6-amino-6-deoxy-α-<smallcap>D</smallcap>-glucopyranosyl-(1→4)-O-[3-deoxy-4-C-methyl-3-(methylamino)-β-<smallcap>L</span>-arabinopyranosyl-(1→6)]-2-deoxy-
- Betamicin [INN]
- Betamicina
- Betamicina [INN-Spanish]
- Betamicine
- Betamicine [INN-French]
- Betamicinum
- Betamicinum [INN-Latin]
- D-Streptamine, O-6-amino-6-deoxy-alpha-D-glucopyranosyl-(1-4)-O-(3-deoxy-4-C-methyl-3-(methylamino)-beta-L-arabinopyranosyl-(1-6))-2-deoxy-
- See more synonyms
Sort by
Found 2 products.
Gentamicin B
CAS:Gentamicin B is an aminoglycoside antibiotic, which is derived from the bacterium Micromonospora. This derivative exhibits its mode of action by binding to the 30S subunit of the bacterial ribosome, disrupting protein synthesis. As a result, it causes misreading of mRNA, ultimately leading to cell death, thereby exhibiting bactericidal effects. Gentamicin B is commonly employed in the treatment of serious infections caused by Gram-negative bacteria, including Pseudomonas, Klebsiella, and Escherichia coli. It is particularly useful in healthcare settings for severe systemic infections, such as those affecting the respiratory tract, urinary tract, skin, and soft tissues. Due to its potent activity, it is often reserved for situations where other antibiotics might be ineffective. Additionally, its use is monitored carefully to avoid potential nephrotoxicity and ototoxicity, common side effects associated with aminoglycosides. Thus, Gentamicin B plays a critical role in the antibiotic arsenal, particularly in hospital settings dealing with resistant bacterial strains.Formula:C19H38N4O10Purity:Min. 95%Molecular weight:482.5 g/mol
