
CAS 37191-69-8: β-Cyclodextrin hydrogen sulfate sodium salt
Formula:C42H70O35·xH2O4S·xNa
InChI:InChI=1S/C42H70O35.Na.H2O4S/c43-1-8-29-15(50)22(57)36(64-8)72-30-9(2-44)66-38(24(59)17(30)52)74-32-11(4-46)68-40(26(61)19(32)54)76-34-13(6-48)70-42(28(63)21(34)56)77-35-14(7-49)69-41(27(62)20(35)55)75-33-12(5-47)67-39(25(60)18(33)53)73-31-10(3-45)65-37(71-29)23(58)16(31)51;;1-5(2,3)4/h8-63H,1-7H2;;(H2,1,2,3,4)/t8-,9-,10-,11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28?,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-;;/m1../s1
InChI key:InChIKey=VRCLBLYZZCJTIX-QGIWKRSGSA-N
SMILES:S(=O)(=O)(O)O.C(O)[C@@H]1[C@@]2([C@H](O)[C@@H](O)[C@](O1)(O[C@@]3([C@@H](CO)O[C@@]([C@H](O)[C@H]3O)(O[C@@]4([C@@H](CO)O[C@@](C(O)[C@H]4O)(O[C@@]5([C@@H](CO)O[C@](O[C@]6([C@H](O)[C@@H](O)[C@@](O[C@]7([C@H](O)[C@@H](O)[C@@](O[C@]8([C@H](O)[C@@H](O)[C@@](O2)(O[C@@H]8CO)[H])[H])(O[C@@H]7CO)[H])[H])(O[C@@H]6CO)[H])[H])([C@H](O)[C@H]5O)[H])[H])[H])[H])[H])[H])[H])[H].[Na]
Synonyms:- 2,4,7,9,12,14,17,19,22,24,27,29,32,34-Tetradecaoxaoctacyclo[31.2.2.2<sup>3,6</sup>.2<sup>8,11</sup>.2<sup>13,16</sup>.2<sup>18,21</sup>.2<sup>23,26</sup>.2<sup>28,31</sup>]nonatetracontane, β-cyclodextrin deriv.
- Sodium salt of sulfated cycloheptaamylose
- beta-Cyclodextrin, sulfated sodium salt
- β-Cyclodextrin hydrogen sulfate sodium salt
- 2,4,7,9,12,14,17,19,22,24,27,29,32,34-Tetradecaoxaoctacyclo[31.2.2.23,6.28,11.213,16.218,21.223,26.228,31]nonatetracontane, β-cyclodextrin deriv.
Sort by
Found 3 products.
b-Cyclodextrin hydrogen sulfate, sodium salt
CAS:This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.Purity:Min. 95%Color and Shape:Powder