
CAS 374633-38-2: 6-Bromo-3-fluoro-2-methylpyridine
Formula:C6H5BrFN
InChI:InChI=1S/C6H5BrFN/c1-4-5(8)2-3-6(7)9-4/h2-3H,1H3
InChI key:InChIKey=BFQONZCQHGIKIY-UHFFFAOYSA-N
SMILES:CC1=C(F)C=CC(Br)=N1
Synonyms:- 2-Bromo-5-fluoro-6-methylpyridine
- 6-Bromo-3-Fluoro-2-Methylpyridine
- Pyridine, 6-bromo-3-fluoro-2-methyl-
Sort by
Found 4 products.
2-Bromo-5-fluoro-6-methylpyridine
CAS:2-Bromo-5-fluoro-6-methylpyridine is a versatile and useful building block that can be used to synthesize complex compounds. This compound is also a high quality chemical with a CAS number of 374633-38-2. It can be used as a reagent, which means it can be used in the laboratory for various chemical reactions, or as a speciality chemical. 2-Bromo-5-fluoro-6-methylpyridine is an intermediate in the synthesis of other chemicals and has been shown to have reactive groups on both ends of the molecule, making it useful for creating scaffolds for larger molecules.Formula:C6H5BrFNPurity:Min. 95%Color and Shape:PowderMolecular weight:190.01 g/molPyridine, 6-bromo-3-fluoro-2-methyl-
CAS:Formula:C6H5BrFNPurity:98%Color and Shape:SolidMolecular weight:190.0136-Bromo-3-fluoro-2-methylpyridine
CAS:6-Bromo-3-fluoro-2-methylpyridineFormula:C6H5BrFNPurity:98%Color and Shape: brown solidMolecular weight:190.01g/mol6-Bromo-3-fluoro-2-methyl-pyridine
CAS:Purity:98.0%Color and Shape:Solid, Off-white solidMolecular weight:190.01499938964844