
CAS 3758-70-1: 1-(4-Nitrophenyl)-1-propanone
Formula:C9H9NO3
InChI:InChI=1S/C9H9NO3/c1-2-9(11)7-3-5-8(6-4-7)10(12)13/h3-6H,2H2,1H3
InChI key:InChIKey=QHTSEJJUUBOESF-UHFFFAOYSA-N
SMILES:C(CC)(=O)C1=CC=C(N(=O)=O)C=C1
Synonyms:- 1-(4-Nitrophenyl)-1-propanone
- 1-Propanone, 1-(4-Nitrophenyl)-
- 4-Nitropropiophenone
- NSC 582
- Propiophenone, 4′-nitro-
- p-Nitropropiophenone
- 1-(4-NITROPHENYL)PROPAN-1-ONE
Sort by
Found 2 products.
4-Nitropropiophenone
CAS:4-Nitropropiophenone is an enantiomer of the hydrolysis product of escola. It has been shown to be optically active and undergoes hydrolysis reactions that are catalyzed by acid and enzymes. Hydrolysis is a process in which a chemical compound is broken down by the addition of water or other solvents. The cleavage reaction can be reversed by the addition of heat or base. Cleavage reactions are used to produce chiral molecules that are not naturally present in nature. Chiral molecules have a non-superimposable mirror image form each other, such as left and right hands. 4-Nitropropiophenone is hydrolyzed by chloramphenicol, an input molecule, to form 1-chloro-4-nitrophenol and 2-hydroxyacetophenone, which then undergoes a transformation reaction with esters to form 3-methylbenzoic acid methyl ester and 3-methylFormula:C9H9NO3Purity:Min. 95%Color and Shape:White PowderMolecular weight:179.17 g/mol