
CAS 3772-13-2: Isobutylenesulfide; 98%
Formula:C4H8S
InChI:InChI=1/C4H8S/c1-4(2)3-5-4/h3H2,1-2H3
SMILES:CC1(C)CS1
Synonyms:- Isobutylene sulfide
- 2,2-Dimethylthiirane
Sort by
Found 3 products.
Isobutylene sulfide
CAS:Isobutylene sulfide is a reactive, cell-binding molecule that contains two functional groups: a cationic polymerization group and a chlorinating agent. Isobutylene sulfide has been shown to be bifunctional, with the ability to bind to target cells and react with hydrogen chloride (HCl) in solution. This reaction forms an intermediate that can be used as a precursor for the synthesis of other molecules. Isobutylene sulfide is processed by covalent bonding with covid-19 pandemic, which is then converted into a drug substance. Covid-19 pandemic is also known as sodium sulfide (Na2S). The use of covid-19 pandemic allows the formation of polyatomic molecules and the production of different drugs from one process.Formula:C4H8SPurity:Min. 98 Area-%Color and Shape:Clear LiquidMolecular weight:88.17 g/molRef: 3D-FI61240
Discontinued productISOBUTYLENE SULFIDE
CAS:Formula:C4H8SPurity:98%Color and Shape:LiquidMolecular weight:88.17132000000001Isobutylene Sulfide
CAS:Formula:C4H8SPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:88.17