CAS 3780-41-4: 3-methyl-1H-pyrrole-2,4-dicarboxylic acid
Formula:C7H7NO4
InChI:InChI=1/C7H7NO4/c1-3-4(6(9)10)2-8-5(3)7(11)12/h2,8H,1H3,(H,9,10)(H,11,12)
SMILES:Cc1c(c[nH]c1C(=O)O)C(=O)O
Synonyms:- 3-Methyl-pyrrole-2,4-dicarboxylic acid
Sort by
Found 4 products.
3-Methylpyrrole-2,4-dicarboxylic acid
CAS:3-Methylpyrrole-2,4-dicarboxylic acidMolecular weight:169.13g/mol3-Methyl-1H-pyrrole-2,4-dicarboxylic acid
CAS:3-Methyl-1H-pyrrole-2,4-dicarboxylic acid (3MP) is a molecule that catalyzes the formation of amides from carboxylic acids and ammonia or primary amines. It also inhibits bacterial growth by binding to the enzyme Gyrase, which is crucial for DNA replication and cell division. The antibacterial activity of 3MP has been shown in vitro using an expression plasmid containing the gene for 3MP synthetase. This protein was expressed in E. coli cells, leading to inhibition of bacterial growth. In addition, 3MP has anticancer activity due to its ability to cause DNA damage and inhibit cellular proliferation.Formula:C7H7NO4Purity:Min. 95%Molecular weight:169.13 g/mol
