
CAS 37905-07-0: (5beta,9beta,10alpha,14beta)-8,14:12,16-diepoxyabieta-11,13(15)-dien-16-one
Formula:C20H26O3
InChI:InChI=1/C20H26O3/c1-11-15-12(22-17(11)21)10-14-19(4)8-5-7-18(2,3)13(19)6-9-20(14)16(15)23-20/h10,13-14,16H,5-9H2,1-4H3/t13-,14+,16-,19-,20+/m1/s1
InChI key:InChIKey=OYXDHOVYZKWSRM-PHJMNMFVSA-N
SMILES:C[C@]12[C@]3([C@]4([C@](O4)(C=5C(=C3)OC(=O)C5C)[H])CC[C@@]1(C(C)(C)CCC2)[H])[H]
Sort by
Found 4 products.
Jolkinolide A
CAS:Jolkinolide A suppresses tumor growth by reducing VEGF in A549 cells and halting HUVEC proliferation and migration via Akt-STAT3-mTOR pathway inhibition.Formula:C20H26O3Purity:98%Color and Shape:SolidMolecular weight:314.42Jolkinolide A
CAS:Jolkinolide A is a diterpenoid lactone, which is a bioactive compound primarily derived from the plant species Euphorbia fischeriana. It exhibits its mode of action primarily through modulation of various signaling pathways involved in inflammation and cancer. Jolkinolide A is known to inhibit the NF-κB pathway, which plays a crucial role in cellular processes such as immune response, cell proliferation, and apoptosis. Additionally, it has been shown to disrupt the PI3K/Akt signaling pathway, which is often implicated in cancer cell survival and proliferation. Jolkinolide A is under investigation for its potential therapeutic applications in treating inflammatory diseases and various forms of cancer. Its ability to target multiple pathways makes it a compound of interest for developing new medications that can address complex disorders with multifaceted pathologies. Researchers continue to explore its efficacy and safety profile in preclinical and clinical settings, aiming to leverage its biological properties for therapeutic interventions.Formula:C20H26O3Purity:Min. 95%Molecular weight:314.4 g/mol