
CAS 3815-22-3: N-methylnaphthalene-2-carboxamide
Formula:C12H11NO
InChI:InChI=1/C12H11NO/c1-13-12(14)11-7-6-9-4-2-3-5-10(9)8-11/h2-8H,1H3,(H,13,14)
Sort by
Found 2 products.
N-Methylnaphthalene-2-carboxamide
CAS:N-Methylnaphthalene-2-carboxamide is a nitroderivative of the alkaloid papaverine and has been shown to have rate enhancement effects on the reaction between methanes and hydrogen chloride. This molecule can be synthesized from naphthalene-2-carboxylic acid and methanes, with high yields. The kinetics of this reaction has been studied using a functional group kinetic method. N-Methylnaphthalene-2-carboxamide has also been used as an efficient method for the synthesis of other nitroderivatives, such as phenylnitronitrile, which are commonly used in the pharmaceutical industry. The binding constants for chloride ions, c-h bonds, magnesium ions, amide groups, and carbonyl groups have all been determined experimentally.Formula:C12H11NOPurity:Min. 95%Molecular weight:185.22 g/mol