CAS 3840-30-0: 3,4,5-Trimethoxybenzyl chloride
Formula:C10H13ClO3
InChI:InChI=1S/C10H13ClO3/c1-12-8-4-7(6-11)5-9(13-2)10(8)14-3/h4-5H,6H2,1-3H3
InChI key:InChIKey=XXRUQNNAKXZSOS-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=C(CCl)C=C1OC
Synonyms:- 1-(Chloromethyl)-3,4,5-trimethoxybenzene
- 3,4,5-Trimethoxybenzylchloride
- 5-(Chloromethyl)-1,2,3-Trimethoxybenzene
- Benzene, 5-(chloromethyl)-1,2,3-trimethoxy-
- NSC 100940
- Toluene, α-chloro-3,4,5-trimethoxy-
- 3,4,5-Trimethoxybenzyl chloride
Sort by
Found 4 products.
3,4,5-Trimethoxybenzyl chloride
CAS:Formula:C10H13ClO3Purity:97%Color and Shape:SolidMolecular weight:216.66143,4,5-Trimethoxybenzyl chloride
CAS:3,4,5-Trimethoxybenzyl chloride (3,4,5-TMBC) is a coumarin derivative that has been shown to have antiproliferative and cytotoxic properties. 3,4,5-TMBC inhibits the growth of bacteria by inhibiting mitochondrial functions. It also has inhibitory properties against the bacterium P. aeruginosa. 3,4,5-TMBC is hydrolyzed in vivo to 3,4,5-trimethoxybenzyl alcohol (TMBAL), which is responsible for its significant cytotoxicity. TMBAL binds to DNA and RNA nucleobases through hydrogen bonding interactions and prevents RNA synthesis by binding to ribosomes. This allows 3,4,5-TMBC to function as an anti-inflammatory agent. The aromatic hydrocarbon group of 3,4,5-TMBC can be used in pharmaceutical preparations as a precursor for the synthesis of other drugsFormula:C10H13ClO3Purity:Min. 95%Color and Shape:PowderMolecular weight:216.66 g/molRef: 3D-FT55079
Discontinued product3,4,5-Trimethoxybenzyl chloride
CAS:Purity:99.0%Color and Shape:SolidMolecular weight:216.660003662109383,4,5-Trimethoxybenzyl chloride
CAS:3,4,5-Trimethoxybenzyl chlorideFormula:C10H13ClO3Purity:95%Color and Shape: faint beige/light brown crystalline solidMolecular weight:216.66g/mol
