CAS 38902-68-0: 6-chloro-N,N-diethyl-1,3,5-triazine-2,4-diamine
Formula:C7H12ClN5
InChI:InChI=1/C7H12ClN5/c1-3-13(4-2)7-11-5(8)10-6(9)12-7/h3-4H2,1-2H3,(H2,9,10,11,12)
SMILES:CCN(CC)c1nc(Cl)nc(=N)[nH]1
Synonyms:- 1,3,5-triazine-2,4-diamine, 6-chloro-N~2~,N~2~-diethyl-
- 6-Chlor-N,N-diethyl-1,3,5-triazin-2,4-diamin
- 6-Chloro-N,N-diéthyl-1,3,5-triazine-2,4-diamine
- 6-Chloro-N,N-diethyl-1,3,5-triazine-2,4-diamine
Sort by
Found 3 products.
6-Chloro-N2,N2-diethyl-1,3,5-triazine-2,4-diamine
CAS:6-Chloro-N2,N2-diethyl-1,3,5-triazine-2,4-diamine is a molecule that was synthesized to mimic the triazine ring system of molybdenum. This molecule has been shown to have potent antimicrobial activity and is able to disrupt bacterial DNA replication. The chemical structure of 6-chloro-N2,N2-diethyl-1,3,5-triazine-2,4-diamine can be imprinted onto other molecules by forming a covalent bond with them. This allows for the development of sensors that can detect bacteria in real time. This molecule could also be used as a template for biomimetic materials.Formula:C7H12ClN5Purity:Min. 95%Molecular weight:201.66 g/mol
