
CAS 39012-01-6: 5,7-dihydroxy-3-(4-hydroxy-3-methoxyphenyl)-6-methoxy-4H-chromen-4-one
Formula:C17H14O7
InChI:InChI=1/C17H14O7/c1-22-12-5-8(3-4-10(12)18)9-7-24-13-6-11(19)17(23-2)16(21)14(13)15(9)20/h3-7,18-19,21H,1-2H3
SMILES:COc1cc(ccc1O)c1coc2cc(c(c(c2c1=O)O)OC)O
Synonyms:- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-(4-hydroxy-3-methoxyphenyl)-6-methoxy-
- 5,7-Dihydroxy-3-(4-hydroxy-3-methoxyphenyl)-6-methoxy-4H-1-benzopyran-4-one
Sort by
Found 6 products.
Iristectorigenin A
CAS:Iristectorigenin A is a naturally occurring isoflavone compound, which is derived from the rhizomes of the Iris plant species, particularly Iris tectorum. As a bioactive flavonoid, it exhibits multiple pharmacological activities owing to its chemical structure. The compound operates primarily by modulating various biochemical pathways, including antioxidant, anti-inflammatory, and potential anti-cancer pathways. This modulation is facilitated by its ability to interact with cellular signaling molecules and enzyme systems, such as cyclooxygenase and lipoxygenase, which are involved in inflammatory processes. Additionally, it has shown potential in inhibiting certain tumor cell lines, suggesting its role in the regulation of cell growth and apoptosis. The applications of Iristectorigenin A are predominantly in the field of biomedical research, where it is utilized to explore new therapeutic approaches for managing oxidative stress and inflammation-related conditions. Its ability to act on multiple biological targets makes it a candidate of interest for further investigation in pharmacodynamics and pharmacokinetics. This compound provides a promising avenue for the development of new drug therapies, particularly in the realms of oncology and chronic inflammatory diseases.Formula:C17H14O7Purity:Min. 95%Color and Shape:PowderMolecular weight:330.29 g/molIristectorigenin A
CAS:Iristectorigenin A is a natural isoflavone isolated from B. chinensis rhizomes with antioxidant activity.Formula:C17H14O7Purity:99.9% - 99.97%Color and Shape:SolidMolecular weight:330.29