
CAS 3907-15-1: 3-Fluoro-4-methoxybenzoyl chloride
Formula:C8H6ClFO2
InChI:InChI=1/C8H6ClFO2/c1-12-7-3-2-5(8(9)11)4-6(7)10/h2-4H,1H3
SMILES:COc1ccc(cc1F)C(=O)Cl
Synonyms:- 3-Fluoro-4-Methoxylbenzoyl Choride
Sort by
Found 4 products.
3-Fluoro-4-methoxybenzoyl chloride
CAS:Purity:98.0%Color and Shape:SolidMolecular weight:188.58000183105473-Fluoro-4-methoxybenzoyl chloride
CAS:The 3-Fluoro-4-methoxybenzoyl chloride is a fluorinated organic compound that is typically used in the synthesis of drugs. The compound can be synthesized by the catalyzed reaction of a chloride and fluoro, which yields this product. It has been shown to have high yields and isomers with an ortho configuration. This product is industrially scalable and can be synthesized in large quantities.Formula:C8H6ClFO2Purity:Min. 95%Molecular weight:188.58 g/molRef: 3D-FF33394
Discontinued product3-Fluoro-4-methoxybenzoyl chloride
CAS:Formula:C8H6ClFO2Purity:97%Color and Shape:SolidMolecular weight:188.58343-Fluoro-4-methoxybenzoyl chloride
CAS:3-Fluoro-4-methoxybenzoyl chlorideColor and Shape:PowderMolecular weight:188.58g/mol