CAS 3927-71-7: (1R)-1-ammonio-2,3-dihydro-1H-indene-1-carboxylate
Formula:C10H11NO2
InChI:InChI=1/C10H11NO2/c11-10(9(12)13)6-5-7-3-1-2-4-8(7)10/h1-4H,5-6,11H2,(H,12,13)/t10-/m1/s1
SMILES:c1ccc2c(c1)CC[C@@]2(C(=O)O)N
Sort by
Found 4 products.
1-amino-2,3-dihydroindene-1-carboxylic acid
CAS:Formula:C10H11NO2Purity:98%Color and Shape:SolidMolecular weight:177.19981-Aminoindan-1-carboxylic acid
CAS:1-Aminoindan-1-carboxylic acid is a non-competitive inhibitor of the ion channel. It binds to the hydrophobic pocket in the transmembrane domain, where it forms hydrogen bonds with amino acids such as leucine and valine. In vivo studies have shown that 1-aminonindan-1 carboxylic acid can block pentylenetetrazole-, electroshock-, and branched chain induced convulsions in mice. The molecular modeling study showed that 1-aminonindan-1 carboxylic acid binds to the sodium channel, blocking its function by binding to one of two possible sites.Formula:C10H11NO2Purity:Min. 95%Molecular weight:177.2 g/mol
