
CAS 4029-69-0: 3,16-bis(acetyloxy)-14-hydroxybufa-20,22-dienolide
Formula:C28H38O7
InChI:InChI=1/C28H38O7/c1-16(29)34-20-9-11-26(3)19(13-20)6-7-22-21(26)10-12-27(4)25(18-5-8-24(31)33-15-18)23(35-17(2)30)14-28(22,27)32/h5,8,15,19-23,25,32H,6-7,9-14H2,1-4H3
SMILES:CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C(c4ccc(=O)oc4)C(CC32O)OC(=O)C)C1
Sort by
Found 4 products.
o-Acetylbufotalin
CAS:o-Acetylbufotalin is a naturally derived steroidal compound, which is extracted from the venom of toads belonging to the Bufonidae family. This compound is part of the bufadienolide class and exhibits its mode of action primarily through the inhibition of Na⁺/K⁺-ATPase. By interfering with these ion pumps, o-Acetylbufotalin influences ion equilibrium across the cell membrane, which can lead to increased intracellular calcium levels and subsequent effects on cardiac muscle contraction. In scientific research, o-Acetylbufotalin is utilized for its potential cardiotonic effects, serving as an important tool in the study of cardiac pharmacology and toxicology. Researchers explore its properties to understand better its mechanisms and potential therapeutic applications or toxicological effects. The compound’s unique origin and properties continue to make it a subject of interest in the ongoing discovery of novel biochemical pathways and drug development. Despite its potent activity, caution is imperative due to its inherent toxicity and potential for adverse effects.Formula:C28H38O7Purity:Min. 95%Molecular weight:486.6 g/mol3-O-Acetylbufotalin
CAS:3-O-Acetylbufotalin is a derivate of bufadienolide with anti-cancer activity.Formula:C28H38O7Purity:98%Color and Shape:SolidMolecular weight:486.6