
CAS 4030-17-5: 1-cyclopropyl-4-methoxybenzene
Formula:C10H12O
InChI:InChI=1/C10H12O/c1-11-10-6-4-9(5-7-10)8-2-3-8/h4-8H,2-3H2,1H3
SMILES:COc1ccc(cc1)C1CC1
Synonyms:- 4-Cyclopropylphenyl methyl ether
- Benzene, 1-Cyclopropyl-4-Methoxy-
- p-Cyclopropylanisole
Sort by
Found 3 products.
a-Cyclopropyl-4-methoxybenzene
CAS:a-Cyclopropyl-4-methoxybenzene (1) is a dinitrogen tetroxide adduct of the Grignard reagent, which can be used as a cross-coupling agent to form cyclopropanes. 1 is activated by the chloride ion and an electron-deficient acceptor, such as an aryl chloride or benzyl group. The reaction proceeds in the presence of a nucleophile, such as an alcohol or amine, and transfer agent such as triethylsilane. The synthesis of cyclopropanes can be achieved through a cross-coupling reaction between two substituted phenyl chlorides and one equivalent of an alcohol or amine. This synthetic route avoids the formation of thermally unstable organometallic intermediates.Formula:C10H12OPurity:Min. 95%Molecular weight:148.2 g/mol1-Cyclopropyl-4-methoxybenzene
CAS:1-Cyclopropyl-4-methoxybenzeneColor and Shape:Low-Melting SolidMolecular weight:148.20g/mol