CAS 40320-60-3: 1-Benzhydrylazetidin-3-one
Formula:C16H15NO
InChI:InChI=1/C16H15NO/c18-15-11-17(12-15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,16H,11-12H2
SMILES:c1ccc(cc1)C(c1ccccc1)N1CC(=O)C1
Synonyms:- 1-(Diphenylmethyl)azetidin-3-on
- 1-(Diphenylmethyl)azetidin-3-one
- 3-Azetidinone, 1-(diphenylmethyl)-
Sort by
Found 5 products.
1-Benzhydrylazetidin-3-one
CAS:The 1-benzhydrylazetidin-3-one molecule has an ionizing potential of 29.6 eV, which is the amount of energy required to remove one electron from the outermost shell of a hydrogen atom. The molecule is photoelectron reactive, with a reaction yield of 0.5%. It reacts with ultraviolet radiation and interacts with other molecules such as azetidine (2-methylaziridine). The 1-benzhydrylazetidin-3-one molecule has an ionization potential of 29.6 eV, which is the amount of energy required to remove one electron from the outermost shell of a hydrogen atom. The molecule is photoelectron reactive, with a reaction yield of 0.5%. It reacts with ultraviolet radiation and interacts with other molecules such as azetidine (2-methylaziridine).Formula:C16H15NOPurity:Min. 95%Color and Shape:White To Beige SolidMolecular weight:237.3 g/mol1-Benzhydrylazetidin-3-one
CAS:Formula:C16H15NOPurity:97%Color and Shape:SolidMolecular weight:237.29641-(Diphenylmethyl)azetidin-3-one
CAS:1-(Diphenylmethyl)azetidin-3-oneFormula:C16H15NOPurity:98%Color and Shape: off-white solidMolecular weight:237.30g/mol1-Benzhydryl-3-azetidinone
CAS:Formula:C16H15NOPurity:>96.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:237.30
