
CAS 40718-08-9: 3,5-dibromo-2-hydroxybenzonitrile
Formula:C7H3Br2NO
InChI:InChI=1/C7H3Br2NO/c8-5-1-4(3-10)7(11)6(9)2-5/h1-2,11H
SMILES:c1c(C#N)c(c(cc1Br)Br)O
Synonyms:- Benzonitrile, 3,5-dibromo-2-hydroxy-
- Hydroxy-3,5-dibromobenzonitrile
- 3,5-Dibromo-2-hydroxybenzonitrile
Sort by
Found 4 products.
3,5-Dibromo-2-hydroxybenzonitrile
CAS:Purity:90.0%Color and Shape:SolidMolecular weight:276.91500854492193,5-DIBROMO-2-HYDROXYBENZONITRILE
CAS:Formula:C7H3Br2NOPurity:95%Color and Shape:SolidMolecular weight:276.91283,5-Dibromo-2-hydroxybenzonitrile
CAS:3,5-Dibromo-2-hydroxybenzonitrile is an organic compound with the formula C6H4Br2O. It is a yellow liquid that is soluble in organic solvents. 3,5-Dibromo-2-hydroxybenzonitrile can be synthesized by reacting tert-butyl nitrite with bromine and acetonitrile in a solvent. The reaction rate of this chemical reaction is rapid and the molecule has been shown to be stable when exposed to light. The hydroxyl group on the molecule makes it hydrophobic, which means it does not dissolve well in water. 3,5-Dibromo-2-hydroxybenzonitrile has a photolabile profile, meaning that it quickly decomposes when exposed to light. This chemical compound has two isomers: synopses A and B. Synopsis A has an electron configuration of 1s22s22pFormula:C7H3Br2NOPurity:Min. 95%Molecular weight:276.92 g/mol