
CAS 40787-48-2: 1,4-dibromo-2,5-diethylbenzene
Formula:C10H12Br2
InChI:InChI=1/C10H12Br2/c1-3-7-5-10(12)8(4-2)6-9(7)11/h5-6H,3-4H2,1-2H3
SMILES:CCc1cc(c(CC)cc1Br)Br
Synonyms:- Benzene, 1,4-Dibromo-2,5-Diethyl-
- 1,4-Dibromo-2,5-diethylbenzene
Sort by
Found 5 products.
1,4-Dibromo-2,5-diethylbenzene
CAS:1,4-Dibromo-2,5-diethylbenzene (DBDE) is a crystalline compound that belongs to the group of mesomorphic compounds. It has a melting point of 45.8°C and a boiling point of 174°C. DBDE is soluble in ether and chloroform but not water. It is also insoluble in acetone, benzene, and carbon tetrachloride. DBDE has been shown to form oligomers with an average molecular weight of about 1000 Da at temperatures below its mesomorphic transition temperature. The molecular structure of DBDE consists of four ethyl groups attached to each bromine atom on the benzene ring. This compound's liquid crystalline phase is hexagonal with a monotropic point group symmetry, which can be seen using microscopy. The mesophase is isotropic, which means that light passing through it will show no preferential directionality or polarization due to its properties as anFormula:C10H12Br2Purity:Min. 95%Molecular weight:292.01 g/mol1,4-Dibromo-2,5-diethylbenzene
CAS:1,4-Dibromo-2,5-diethylbenzenePurity:97+%Molecular weight:292.01g/mol1,4-Dibromo-2,5-diethylbenzene
CAS:Formula:C10H12Br2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:292.011,4-DIBROMO-2,5-DIETHYLBENZENE
CAS:Formula:C10H12Br2Purity:95%Color and Shape:SolidMolecular weight:292.0103