
CAS 41870-24-0: (4-methoxy-3-nitrophenyl)methanol
Formula:C8H9NO4
InChI:InChI=1/C8H9NO4/c1-13-8-3-2-6(5-10)4-7(8)9(11)12/h2-4,10H,5H2,1H3
SMILES:COc1ccc(cc1N(=O)=O)CO
Sort by
Found 4 products.
(4-Methoxy-3-nitrophenyl)methanol
CAS:Formula:C8H9NO4Purity:95%Color and Shape:SolidMolecular weight:183.1614(4-Methoxy-3-nitrophenyl)methanol
CAS:4-Methoxy-3-nitrophenyl)methanol (4MNPM) is a benzothiazine that is commonly used as a cocatalyst for the oxidation of alcohols to their corresponding aldehydes or ketones. It is also used as an intermediate in the synthesis of other aromatic compounds, such as benzyl alcohols and thioglycolate. 4MNPM can be obtained by reacting methyl thioglycolate with an appropriate substituent, such as benzyl alcohols, in the presence of an acid catalyst. The reaction can be carried out under aerobic conditions due to the presence of oxygen. The product can be purified by distillation or recrystallization. Benzothiazines are nucleophilic compounds that react with 3-nitrobenzoic acid to give nitrobenzothiazoles. These reactions require a cocatalyst to activate the carboxylic acid group on the molecule so thatFormula:C8H9NO4Purity:Min. 95%Molecular weight:183.16 g/molRef: 3D-FM123646
Discontinued product(4-Methoxy-3-nitrophenyl)methanol
CAS:(4-Methoxy-3-nitrophenyl)methanolPurity:97%Molecular weight:183.16g/mol