
CAS 42135-78-4: 4-(1-Naphthyl)-3-thiosemicarbazide
Formula:C11H11N3S
InChI:InChI=1/C11H11N3S/c12-14-11(15)13-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,12H2,(H2,13,14,15)
SMILES:c1ccc2c(c1)cccc2N=C(NN)S
Synonyms:- N-naphthalen-1-ylhydrazinecarbothioamide
Sort by
Found 4 products.
4-(1-Naphthyl)-3-thiosemicarbazide
CAS:4-(1-Naphthyl)-3-thiosemicarbazide is a compound that has been synthesized and characterized by x-ray diffraction data. It has been shown to interact with tryptophan residues in the active site of the enzyme nitro reductase. This interaction is thought to be due to ionic interactions between the nitro groups on 4-(1-naphthyl)-3-thiosemicarbazide and hydrogen bond formation between the nitro groups and hydroxyl groups on the tryptophan residues. Techniques such as electrospray ionisation mass spectrometry have been used to identify this compound. The constant for this compound is found to be K=2.8x10^5 M^(-1).Formula:C11H11N3SPurity:Min. 95%Molecular weight:217.29 g/molN-(Naphthalen-1-yl)hydrazinecarbothioamide
CAS:Formula:C11H11N3SColor and Shape:SolidMolecular weight:217.29014-(1-Naphthyl)-3-thiosemicarbazide
CAS:4-(1-Naphthyl)-3-thiosemicarbazideMolecular weight:217.29014g/mol