
CAS 42204-14-8: Acetic acid, rhodium salt (1:?)
Formula:C2H4O2·xRh
InChI:InChI=1S/C2H4O2.Rh/c1-2(3)4;/h1H3,(H,3,4);
InChI key:InChIKey=NENDHUHGFRLXEN-UHFFFAOYSA-N
SMILES:C(C)(O)=O.[Rh]
Synonyms:- Acetate, Rhodium Salt
- Acetic acid, rhodium salt
- Acetic acid, rhodium salt (1:?)
- Rhodium(2+) diacetate
- Rhodium acetate
Sort by
Found 5 products.
Rhodium(III) acetate
CAS:Rhodium(III) acetate is a surfactant that has been shown to increase the efficiency of catalytic hydrogenations. It has also been shown to be effective as an herbicide against phytophagous insects such as aphids. Rhodium(III) acetate at high concentrations can replicate DNA, but not at lower concentrations. Pairwise treatments with phosphine have been shown to reduce the amount of rhodium needed for replication, while increasing the rate of replication. The nature and concentration of surfactants plays a significant role in the effectiveness of replication.Formula:RhC2H3O2Purity:Min. 95%Molecular weight:161.95 g/molRef: 3D-FR55831
Discontinued product