CAS 42205-74-3: 4-(1,1-Dimethylethyl)-2-pyridinecarboxylic acid
Formula:C10H13NO2
InChI:InChI=1S/C10H13NO2/c1-10(2,3)7-4-5-11-8(6-7)9(12)13/h4-6H,1-3H3,(H,12,13)
InChI key:InChIKey=HDKBJZCKLMQKKD-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C=1C=C(C(O)=O)N=CC1
Synonyms:- 2-Pyridinecarboxylic acid, 4-(1,1-dimethylethyl)-
- 4-tert-Butylpyridine-2-carboxylic acid
- 4-(1,1-Dimethylethyl)-2-pyridinecarboxylic acid
Sort by
Found 4 products.
4-(tert-Butyl)picolinic acid
CAS:4-(tert-Butyl)picolinic acid is a functional theory that describes the interaction of ligands with metal complexes. The theory is based on the observation that picolinic acid and its derivatives can bind to palladium complexes, which leads to the formation of a mononuclear ligand. The ancillary ligands are not directly involved in the reaction, but they can provide stability by binding to the metal complex. 4-(tert-Butyl)picolinic acid has been synthetically prepared by reacting picolinic acid with tert-butyl chloride. This compound has shown quantum efficiency and ancillary ligand efficiency in light emission devices.Formula:C10H13NO2Purity:Min. 95%Molecular weight:179.22 g/mol
