
CAS 42220-80-4: 3-(2,3-Dimethoxyphenyl)-1-(2-hydroxyphenyl)-2-propen-1-one
Formula:C17H16O4
InChI:InChI=1S/C17H16O4/c1-20-16-9-5-6-12(17(16)21-2)10-11-15(19)13-7-3-4-8-14(13)18/h3-11,18H,1-2H3
InChI key:InChIKey=HKKXNGSRSNONCJ-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC(=O)C2=C(O)C=CC=C2)C=CC=C1OC
Synonyms:- 2′-Hydroxy-2,3-dimethoxychalcone
- Chalcone, 2′-hydroxy-2,3-dimethoxy-
- 2-Propen-1-one, 3-(2,3-dimethoxyphenyl)-1-(2-hydroxyphenyl)-
- 3-(2,3-Dimethoxyphenyl)-1-(2-hydroxyphenyl)-2-propen-1-one
Sort by
Found 2 products.
2'-Hydroxy-2,3-dimethoxychalcone
CAS:α-Gracinoic acid, a derivative of Chalcone, exhibits anti-inflammatory activity. This compound inhibits the production of nitric oxide catalyzed by inducible nitric oxide synthase (iNOS) in RAW 264.7 cells treated with lipopolysaccharide (LPS).Formula:C17H16O4Color and Shape:SolidMolecular weight:284.312,3-Dimethoxy-2'-hydroxychalcone
CAS:2,3-Dimethoxy-2'-hydroxychalcone is a synthetic organic compound, which is derived from the chalcone class of flavonoids. It is structurally characterized by a core chalcone backbone, enhanced by the addition of methoxy and hydroxy functional groups. These modifications contribute to its unique chemical properties and potential biological activity. The source of this compound typically involves organic synthesis pathways, employing catalytic and chemical modifications to introduce the methoxy and hydroxy groups strategically. By manipulating these structural elements, the compound can exhibit diverse modes of action. Notably, it acts as an antioxidant, scavenging free radicals and reducing oxidative stress within biological systems. Additionally, it shows potential anti-inflammatory effects by modulating specific signaling pathways in cells, such as the inhibition of NF-kB activation. 2,3-Dimethoxy-2'-hydroxychalcone finds applications in scientific research, particularly in studies exploring its pharmacological efficacy and mechanisms of action. Its potential to mitigate oxidative damage and inflammation positions it as a candidate for developing therapeutic agents against diseases characterized by these underlying issues, such as neurodegenerative disorders and chronic inflammatory conditions. Scientists may also utilize this compound in investigations aimed at understanding the broader implications of chalcones in medicinal chemistry.Formula:C17H16O4Purity:Min. 95%Color and Shape:White To Yellow SolidMolecular weight:284.31 g/mol