CAS 42521-08-4: 2,6-Dichloropyridine-4-carbonyl chloride
Formula:C6H2Cl3NO
InChI:InChI=1/C6H2Cl3NO/c7-4-1-3(6(9)11)2-5(8)10-4/h1-2H
SMILES:c1c(cc(Cl)nc1Cl)C(=O)Cl
Synonyms:- 2,6-Dichloropyridine-4-carboxylic chloride
Sort by
Found 4 products.
2,6-Dichloropyridine-4-carbonyl chloride
CAS:Purity:95.0%Color and Shape:Solid, Low Melting SolidMolecular weight:210.442,6-DICHLOROPYRIDINE-4-CARBONYL CHLORIDE
CAS:Formula:C6H2Cl3NOPurity:97%Color and Shape:LiquidMolecular weight:210.44522,6-Dichloropyridine-4-carbonylchloride
CAS:2,6-Dichloropyridine-4-carbonylchloride is an aralkyl compound that can be synthesized from 2,6-dichloropyridine. The compound has been shown to have a fungicidal effect against filamentous fungi by inhibiting the carboxamides that are required for cell wall synthesis. It also inhibits the binding of integrin receptor to amide nitro groups, preventing cell division and the growth of plant diseases, such as viruses or bacteria. The scalable synthesis of this compound makes it a good candidate for use in agriculture as an agrochemical.Formula:C6H2Cl3NOPurity:Min. 95%Molecular weight:210.44 g/molRef: 3D-FD149448
Discontinued product2,6-Dichloropyridine-4-carbonyl chloride
CAS:2,6-Dichloropyridine-4-carbonyl chloridePurity:95Color and Shape:LiquidMolecular weight:210.45g/mol
