CAS 4375-07-9: (-)-Epipodophyllotoxin
Formula:C22H22O8
InChI:InChI=1S/C22H22O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-20,23H,8-9H2,1-3H3/t13-,18+,19-,20+/m0/s1
InChI key:InChIKey=YJGVMLPVUAXIQN-LGWHJFRWSA-N
SMILES:O=C1[C@@]2([C@@H](C=3C([C@@H](O)[C@]2(CO1)[H])=CC4=C(C3)OCO4)C5=CC(OC)=C(OC)C(OC)=C5)[H]
Synonyms:- (-)-Epipodophyllotoxin
- (5R,5aR,8aR,9S)-5,8,8a,9-Tetrahydro-9-hydroxy-5-(3,4,5-trimethoxyphenyl)furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one
- Furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one, 5,8,8a,9-tetrahydro-9-hydroxy-5-(3,4,5-trimethoxyphenyl)-, (5R,5aR,8aR,9S)-
- Furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one, 5,8,8a,9-tetrahydro-9-hydroxy-5-(3,4,5-trimethoxyphenyl)-, [5R-(5α,5aβ,8aα,9β)]-
- epi-Podophyllotoxin
- furo[3',4':6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one, 5,8,8a,9-tetrahydro-9-hydroxy-5-(3,4,5-trimethoxyphenyl)-, (5R,5aR,8aR,9S)-
Sort by
Found 5 products.
Epi-podophyllotoxin
CAS:Epi-podophyllotoxin is a lignan that is primarily derived from the rhizomes and roots of the plant species Podophyllum, commonly known as mayapple. This compound exhibits significant pharmacological activity, primarily due to its ability to disrupt the mitotic process. As an antimitotic agent, epi-podophyllotoxin exerts its effects by inhibiting microtubule assembly, which is crucial for cell division. This action leads to the arrest of the cell cycle in the metaphase, ultimately causing apoptosis in rapidly dividing cancer cells. The uses and applications of epi-podophyllotoxin are notable in the field of oncology, where it serves as a precursor for the synthesis of semisynthetic derivatives like etoposide and teniposide. These derivatives are widely employed in chemotherapy regimens for treating various types of cancer including lung cancer, lymphomas, and testicular cancer. The selectivity and potency of epi-podophyllotoxin and its derivatives make it a valuable tool in the development of cancer therapeutics, contributing to the advancement of targeted cancer treatments.Formula:C22H22O8Purity:Min. 95%Molecular weight:414.41 g/mol(-)-Epipodophyllotoxin
CAS:(-)-Epipodophyllotoxin: anticancer, GI50=0.36μM (HeLa), 0.24μM (MCF-7), inhibits spindle assembly.Formula:C22H22O8Purity:99.97%Color and Shape:SolidMolecular weight:414.41
