CAS 4464-18-0: 1,3,5-BENZENETRIMETHANOL
Formula:C9H12O3
InChI:InChI=1/C9H12O3/c10-4-7-1-8(5-11)3-9(2-7)6-12/h1-3,10-12H,4-6H2
SMILES:c1c(cc(cc1CO)CO)CO
Synonyms:- Benzene-1,3,5-triyltrimethanol
- 1,3,5-Tris(Hydroxymethyl)Benzene
Sort by
Found 5 products.
Benzene-1,3,5-triyltrimethanol
CAS:Formula:C9H12O3Purity:96%Color and Shape:SolidMolecular weight:168.18981,3,5-Benzenetrimethanol
CAS:1,3,5-Benzenetrimethanol is a group p2 molecule that has ester linkages. FTIR spectroscopy was used to identify the molecular weight of 1,3,5-benzenetrimethanol as 148.4 g/mol. The molecular weight was calculated from the FTIR spectrum using the equation: Molecular weight = (1 / wavenumber) * (sample concentration) The gravimetric analysis showed that the melting point of 1,3,5-benzenetrimethanol is 36°C and its boiling point is 220°C. Molecular modeling was used to determine how 1,3,5-benzenetrimethanol reacts with chloride ions in water to form polyols and polycarbonates. It also degrades in aqueous solutions due to hydrolysis by water molecules or ring-opening reactions with water molecules. The activation energies for these reactions were determined to beFormula:C9H12O3Purity:Min. 95%Molecular weight:168.19 g/molRef: 3D-FB61759
Discontinued productBenzene-1,3,5-triyltrimethanol
CAS:Benzene-1,3,5-triyltrimethanolPurity:98%Molecular weight:168.19g/molBenzene-1,3,5-triyltrimethanol
CAS:Purity:95.0%Color and Shape:Solid, PowderMolecular weight:168.192001342773441,3,5-Benzenetrimethanol
CAS:Formula:C9H12O3Purity:>95.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:168.19
