
CAS 4482-03-5: 2,2',4,4',6,6'-hexamethylbiphenyl
Formula:C18H22
InChI:InChI=1/C18H22/c1-11-7-13(3)17(14(4)8-11)18-15(5)9-12(2)10-16(18)6/h7-10H,1-6H3
SMILES:Cc1cc(C)c(c(C)c1)c1c(C)cc(C)cc1C
Synonyms:- 2,4,6,2',4',6'-Hexamethylbiphenyl
- Bimesityl
- Biphenyl, 2,2',4,4',6,6'-hexamethyl-
Sort by
Found 3 products.
2,2',4,4',6,6'-Hexamethyl-1,1'-biphenyl
CAS:Formula:C18H22Purity:95%Color and Shape:SolidMolecular weight:238.367279999999942,2',4,4',6,6'-Hexamethyl-1,1'-biphenyl
CAS:2,2',4,4',6,6'-Hexamethyl-1,1'-biphenyl is a biphenyl compound that exists as a colorless liquid at room temperature. It has electronic interactions with other molecules and can undergo protonation. 2,2',4,4',6,6'-Hexamethyl-1,1'-biphenyl can be used to make sulfonanilides and carbon tetrachloride. This chemical also reacts with hydrogen chloride to produce 2-chloroethanol and chloroform. The molecule has an amide bond that is susceptible to hydrolysis by base or acid.Formula:C18H22Purity:Min. 95%Molecular weight:238.37 g/mol