
CAS 4483-47-0: 1-(3,4-dimethoxyphenyl)-3-ethyl-5,6-dimethoxy-2-methyl-2,3-dihydro-1H-indene
Formula:C22H28O4
InChI:InChI=1/C22H28O4/c1-7-15-13(2)22(14-8-9-18(23-3)19(10-14)24-4)17-12-21(26-6)20(25-5)11-16(15)17/h8-13,15,22H,7H2,1-6H3
SMILES:CCC1C(C)C(c2ccc(c(c2)OC)OC)c2cc(c(cc12)OC)OC
Sort by
Found 4 products.
Diisohomoeugenol
CAS:Diisohomoeugenol is a chemical compound, which is a plant-derived phenolic compound known for its biological activities. Sourced primarily from essential oils of various aromatic plants, it exhibits notable bioactive properties due to its structural similarity to other eugenol derivatives. Its mode of action involves disrupting microbial cell membranes, leading to enhanced antimicrobial effects. Additionally, it acts as a potent antioxidant, scavenging free radicals and protecting against oxidative stress. The uses and applications of Diisohomoeugenol are diverse and significant in scientific research and industry. It is employed in pharmaceutical research for developing antimicrobial agents due to its efficacy against various pathogens. Additionally, its antioxidant properties make it valuable in the cosmetic and food industries, where it is used to extend the shelf life of products and enhance their safety and nutritional profile. Researchers continue to explore its potential in various therapeutic fields, aiming to harness its natural bioactivities for innovative applications.Formula:C22H28O4Purity:Min. 95%Molecular weight:356.5 g/molTofisopam Impurity 5
CAS:Formula:C22H28O4Color and Shape:White To Off-White SolidMolecular weight:356.46