
CAS 449733-84-0: 2-(4-hydroxyphenyl)ethyl 6-O-{[(2S,3E)-3-ethylidene-2-(beta-D-glucopyranosyloxy)-5-(methoxycarbonyl)-3,4-dihydro-2H-pyran-4-yl]acetyl}-beta-D-glucopyranoside
Formula:C31H42O17
InChI:InChI=1/C31H42O17/c1-3-16-17(18(28(41)42-2)12-45-29(16)48-31-27(40)24(37)22(35)19(11-32)46-31)10-21(34)44-13-20-23(36)25(38)26(39)30(47-20)43-9-8-14-4-6-15(33)7-5-14/h3-7,12,17,19-20,22-27,29-33,35-40H,8-11,13H2,1-2H3/b16-3+/t17?,19-,20-,22-,23-,24+,25+,26-,27-,29+,30-,31+/m1/s1
Synonyms:- Specneuzhenide
Sort by
Found 6 products.
(8Z)-Nuzhenide
CAS:Nuezhenide significantly protects human neuroblastoma SH-SY5Y cells from 6-hydroxydopamine-induced neurotoxicity.Formula:C31H42O17Purity:95%~99%Color and Shape:PowderMolecular weight:686.66Specneuzhenide
CAS:Specneuzhenide is a phenol glycoside from Ligustrum sinense with anti-tumor, anti-angiogenic, and vision benefits.Formula:C31H42O17Purity:95.36% - 98%Color and Shape:SolidMolecular weight:686.66Specneuzhenide
CAS:Specneuzhenide is a secoiridoid glycoside, which is a bioactive compound derived primarily from the fruits of Ligustrum lucidum, commonly known as glossy privet. This compound is characterized by its unique structure, which includes a glycoside linkage that contributes to its biological efficacy. As a natural product, specneuzhenide exhibits a range of pharmacological activities, primarily functioning by modulating biochemical pathways related to inflammation, oxidative stress, and immune response. The mode of action is complex, involving antioxidant properties and the regulation of gene expression associated with cellular protection mechanisms. Specneuzhenide is of considerable interest in the scientific community due to its potential therapeutic applications. It is studied extensively for its role in mitigating conditions such as inflammation, cancer, and neurodegenerative diseases. Experimental studies suggest its efficacy in enhancing the body's defense mechanisms, although detailed mechanistic insights and clinical validations are still ongoing. This compound represents a significant area of interest for researchers exploring novel therapeutic agents derived from natural sources.Formula:C31H42O17Purity:Min. 95%Molecular weight:686.65 g/mol