
CAS 451-81-0: 2-Fluorobenzeneacetyl chloride
Formula:C8H6ClFO
InChI:InChI=1S/C8H6ClFO/c9-8(11)5-6-3-1-2-4-7(6)10/h1-4H,5H2
InChI key:InChIKey=KUMKNGTWQNSAQW-UHFFFAOYSA-N
SMILES:C(C(Cl)=O)C1=C(F)C=CC=C1
Synonyms:- 2-(2'-Fluorophenyl)acetyl chloride
- 2-Fluorobenzeneacetyl chloride
- Acetyl chloride, (o-fluorophenyl)-
- Benzeneacetyl chloride, 2-fluoro-
- o-Fluorophenylacetyl chloride
Sort by
Found 4 products.
2-Fluorophenylacetylchloride
CAS:Purity:97.0%Color and Shape:LiquidMolecular weight:172.58000183105472-Fluorophenylacetyl chloride
CAS:2-Fluorophenylacetyl chloride is a chlorinating agent that selectively adds fluorine to carbonyl groups. It is used in the synthesis of homochiral synthons and in the production of fluorinated pharmaceuticals. The stereochemical outcome depends on the enolate employed, with an enolate derived from a chiral ketone or alcohol typically giving rise to a single diastereomer. The stereoselective addition of 2-fluorophenylacetyl chloride to alkenes is accomplished using a catalytic system that employs cyclopentadiene as the catalyst.Formula:C8H6ClFOPurity:Min. 95%Molecular weight:172.58 g/mol2-(2-Fluorophenyl)acetyl chloride
CAS:Formula:C8H6ClFOPurity:%Color and Shape:LiquidMolecular weight:172.58404322-Fluorophenylacetyl chloride
CAS:2-Fluorophenylacetyl chlorideFormula:C8H6ClFOPurity:By gc: 97.2% (Typical Value in Batch COA)Color and Shape: colourless oilMolecular weight:172.58g/mol