
CAS 454-57-9: fluoro(dimethyl)phenylsilane
Formula:C8H11FSi
InChI:InChI=1/C8H11FSi/c1-10(2,9)8-6-4-3-5-7-8/h3-7H,1-2H3
SMILES:C[Si](C)(c1ccccc1)F
Synonyms:- Benzene, (fluorodimethylsilyl)-
- Fluorodimethylphenylsilane
- Silane, fluorodimethylphenyl-
- Fluoro(dimethyl)phenylsilane
Sort by
Found 2 products.
Dimethylphenylfluorosilane
CAS:Dimethylphenylfluorosilane is a primary amino acid that contains both a hydroxy group and a phenoxy group. It is expressed in plants, fungi, and animals, and can be synthesized by the reaction of hydrochloric acid with fluorine gas. Dimethylphenylfluorosilane can be used to manufacture polysiloxanes or for uv irradiation. This compound is toxic at high concentrations because it causes the formation of hydrofluoric acid when mixed with water. Dimethylphenylfluorosilane has a viscosity that is greater than that of water, and an aromatic hydrocarbon structure. It reacts with hydrogen chloride gas to form trifluoride ions.Formula:C8H11FSiPurity:Min. 95%Molecular weight:154.26 g/mol