CAS 4547-57-3: 4-Butoxybenzeneacetic acid
Formula:C12H16O3
InChI:InChI=1S/C12H16O3/c1-2-3-8-15-11-6-4-10(5-7-11)9-12(13)14/h4-7H,2-3,8-9H2,1H3,(H,13,14)
InChI key:InChIKey=KLJMYYFCWBVKEE-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=CC=C(OCCCC)C=C1
Synonyms:- (4-Butoxyphenyl)Acetate
- (p-Butoxyphenyl)acetic acid
- 2-(4-Butoxyphenyl)acetic acid
- 4-(n-Butoxy)phenylacetic acid
- 4-Butoxybenzeneacetic acid
- 4-n-Butoxybenzeneacetic acid
- 4-n-Butoxyphenylacetic acid
- Acetic acid, (p-butoxyphenyl)-
- Benzeneacetic acid, 4-butoxy-
- 4-Butoxyphenylacetic acid
Sort by
Found 9 products.
2-(4-Butoxyphenyl)acetic Acid
CAS:Controlled ProductFormula:C12H16O3Color and Shape:NeatMolecular weight:208.254-(n-Butoxy)Phenylacetic Acid
CAS:4-(n-Butoxy)Phenylacetic AcidPurity:99%+Molecular weight:208.25g/mol4-Butoxyphenylacetic Acid
CAS:Formula:C12H16O3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:208.264-(N-Butoxy)phenyl acetic acid
CAS:4-(N-Butoxy)phenyl acetic acid is a hydroxamic acid that has been shown to be mutagenic in Salmonella typhimurium. 4-(N-Butoxy)phenyl acetic acid is a ligand that binds to the metal atom of the enzyme hydroxylamine, preventing it from binding to other compounds. This results in an increase in the production of hydroxylamine, which leads to DNA damage and cell death. 4-(N-Butoxy)phenyl acetic acid also has catalytic properties and can interact with chloride ions, due to its electronegativity.Formula:C12H16O3Purity:Min. 98 Area-%Color and Shape:Off-White PowderMolecular weight:208.25 g/mol2-(4-Butoxyphenyl)acetic acid
CAS:Formula:C12H16O3Purity:95%Color and Shape:SolidMolecular weight:208.2536
