(3-Chloropyridin-4-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a chlorinated pyridine ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, owing to the boronic acid moiety. The presence of the chlorine atom on the pyridine ring influences its reactivity and can participate in various chemical reactions, including Suzuki coupling, which is significant in organic synthesis for forming carbon-carbon bonds. The boronic acid group allows for the formation of reversible complexes with diols, making it useful in applications such as drug development and materials science. Additionally, (3-Chloropyridin-4-yl)boronic acid can serve as a building block in the synthesis of more complex organic molecules. Its unique structural features and reactivity profile make it a valuable compound in both academic research and industrial applications.

(3-Chloropyridin-4-yl)boronic acid

458532-98-4: (3-Chloro-4-pyridine)boronic acid, (3-Chloro-4-pyridinyl)boronic acid, (3-Chloro-4-pyridyl)boronic acid, (3-Chloropyridin-4-yl)boronic acid, 3-Chloro-4-pyridineboronicacid, 3-Chloropyridine-4-boronic acid, B-(3-Chloro-4-pyridinyl)boronic acid, Boronic acid, (3-chloro-4-pyridinyl)-, Boronic acid, B-(3-chloro-4-pyridinyl)-

Please enquire for more information about 3-Chloropyridine-4-boronic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

CAS 458532-98-4: (3-Chloropyridin-4-yl)boronic acid

3-Chloropyridine-4-boronic acid

Ref: 3D-FC11893

Boronic acid, (3-chloro-4-pyridinyl)-

Ref: IN-DA00D7ZT

3-Chloropyridine-4-boronic acid

Ref: 54-OR7185

3-Chloro-4-pyridineboronic acid

Ref: 10-F049278