
CAS 4626-22-6: 2,3-Dihydro-7-hydroxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one
Formula:C16H14O4
InChI:InChI=1S/C16H14O4/c1-19-12-5-2-10(3-6-12)14-9-20-15-8-11(17)4-7-13(15)16(14)18/h2-8,14,17H,9H2,1H3
InChI key:InChIKey=INYISIYHXQDCPK-UHFFFAOYSA-N
SMILES:O=C1C(COC=2C1=CC=C(O)C2)C3=CC=C(OC)C=C3
Synonyms:- 2,3-Dihydro-7-hydroxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- Dihydroformononetin
- Isoflavanone, 7-hydroxy-4′-methoxy-
- Isoflavanone,7-hydroxy-4'-methoxy- (7CI,8CI)
- 4H-1-Benzopyran-4-one, 2,3-dihydro-7-hydroxy-3-(4-methoxyphenyl)-
Sort by
Found 2 products.
Dihydroformononetin
CAS:Dihydroformononetin is an isoflavonoid phytoestrogen, which is a type of naturally occurring compound found primarily in leguminous plants. It is derived from plant sources such as red clover and soybeans, known for their rich isoflavone content. This compound undergoes metabolic conversion in plants and potentially in the human body, exerting effects through interactions with estrogen receptors. The mode of action of dihydroformononetin involves binding to estrogen receptors, mimicking estrogenic activity, and potentially influencing pathways related to hormonal balance and cellular processes. It can modulate different cellular pathways and exhibit antioxidant properties, adding to its pharmacological profile. Dihydroformononetin is studied for its applications in health and medicine. Its estrogenic activity makes it a candidate for research in hormone-related conditions such as menopause, osteoporosis, and cardiovascular health. Furthermore, its antioxidant capacity and ability to affect cellular pathways provide additional avenues for exploring anti-inflammatory and anticancer properties. Researchers are particularly interested in its role in modulating signaling pathways, which may have therapeutic implications for various diseases. However, more studies are necessary to fully understand its efficacy and safety profile.Formula:C16H14O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:270.28 g/molDihydroformononetin
CAS:Controlled ProductApplications Dihydroformononetin (cas# 4626-22-6) is a useful research chemical.Formula:C16H14O4Color and Shape:NeatMolecular weight:270.281