CAS 4703-15-5: N-(2,6-dimethylphenyl)-4-methylbenzenesulfonamide
Formula:C15H17NO2S
InChI:InChI=1/C15H17NO2S/c1-11-7-9-14(10-8-11)19(17,18)16-15-12(2)5-4-6-13(15)3/h4-10,16H,1-3H3
SMILES:Cc1ccc(cc1)S(=O)(=O)Nc1c(C)cccc1C
Synonyms:- benzenesulfonamide, N-(2,6-dimethylphenyl)-4-methyl-
Sort by
Found 4 products.
N-(2,6-Dimethylphenyl)-4-Methylbenzenesulfonamide
CAS:N-(2,6-Dimethylphenyl)-4-MethylbenzenesulfonamidePurity:99%Molecular weight:275.37g/molN-(2,6-dimethylphenyl)-4-methylbenzenesulfonamide
CAS:Formula:C15H17NO2SPurity:97%Color and Shape:SolidMolecular weight:275.366N-(2,6-Dimethylphenyl)-4-methylbenzenesulfonamide
CAS:N-(2,6-Dimethylphenyl)-4-methylbenzenesulfonamide is a torsional molecule with the average C atoms of the methyl group and the phenyl groups making an angle of about 120°. The three N atoms are in a plane, with two hydrogen bonds between them. The sulfur atom is bonded to four other atoms (C, O, H, and N) by single bonds. The nitrogen atom has a triple bond to the oxygen atom and a double bond to the carbon atom.Formula:C15H17NO2SPurity:Min. 95%Molecular weight:275.37 g/mol
