CAS 4751-99-9: 1-(diaminomethylidene)-2-(2-methylphenyl)guanidine hydrochloride
Formula:C9H14ClN5
InChI:InChI=1/C9H13N5.ClH/c1-6-4-2-3-5-7(6)13-9(12)14-8(10)11;/h2-5H,1H3,(H6,10,11,12,13,14);1H
SMILES:Cc1ccccc1NC(=N)NC(=N)N.Cl
Synonyms:- 1-{[{[Amino(Imino)Methyl]Amino}(Imino)Methyl]Amino}-2-Methylbenzene Hydrochloride
- imidodicarbonimidic diamide, N-(2-methylphenyl)-, hydrochloride (1:1)
- N-(2-methylphenyl)imidodicarbonimidic diamide hydrochloride
- N-(2-Methylphenyl)imidodicarbonimidic diamide hydrochloride (1:1)
Sort by
Found 2 products.
o-Tolylbiguanide hydrochloride
CAS:o-Tolylbiguanide hydrochloride is a copper-containing antimicrobial agent that has been synthesised and used to treat Gram-negative bacteria. It is an anion, which means it can be reduced by agents such as formaldehyde and chloride. o-Tolylbiguanide hydrochloride binds to the anionic groups of the bacterial cell wall, which are found in proteins and lipids. This binding prevents the formation of a covalent bond between the copper ion and the bacterial cell wall, preventing further growth. The elimination of this compound in vivo is thought to be due to its organic ligands.Formula:C9H14ClN5Purity:Min. 95%Molecular weight:227.69 g/mol
