CAS 4766-33-0: 5-bromonaphthalen-1-amine
Formula:C10H8BrN
InChI:InChI=1/C10H8BrN/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1-6H,12H2
SMILES:C1=CC2=C(C=CC=C2N)C(=C1)Br
Synonyms:- 1-Naphthalenamine, 5-bromo-
- 5-Bromo-Naphthalen-1-Ylamine
Sort by
Found 5 products.
5-Bromo-naphthalen-1-ylamine
CAS:5-Bromo-naphthalen-1-ylamine is a chemical compound that has fluorescence properties. It is synthesized from bromonaphthalene and an amine in the presence of hydrogen gas. This chemical has two isomers, with the alpha form being more soluble in organic solvents and the beta form having a higher fluorescence quantum yield. 5-Bromo-naphthalen-1-ylamine was used to produce monolayers on gold surfaces with different functionalities. These monolayers were then used as sensors for various compounds such as phenols, thiophenes, and halides.Formula:C10H8BrNPurity:Min. 95%Molecular weight:222.08 g/molRef: 3D-FB29866
Discontinued product5-BROMO-NAPHTHALEN-1-YLAMINE
CAS:Formula:C10H8BrNPurity:98%Color and Shape:SolidMolecular weight:222.08121-Amino-5-bromonaphthalene
CAS:1-Amino-5-bromonaphthaleneFormula:C10H8BrNPurity:95%Color and Shape: solidMolecular weight:222.08g/mol5-Bromonaphthalen-1-amine
CAS:Controlled ProductFormula:C10H8NBrColor and Shape:NeatMolecular weight:222.08
