CAS 477-85-0: Obtusifolin
Formula:C16H12O5
InChI:InChI=1S/C16H12O5/c1-7-6-9-12(16(21-2)13(7)18)15(20)11-8(14(9)19)4-3-5-10(11)17/h3-6,17-18H,1-2H3
InChI key:InChIKey=NYRXUBDGDSRBGB-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(C(=O)C=3C(C2=O)=C(O)C=CC3)=CC(C)=C1O
Synonyms:- 2,8-Dihydroxy-1-methoxy-3-methyl-9,10-anthracenedione
- 2,8-Dihydroxy-1-methoxy-3-methyl-9,10-anthraquinone
- 9,10-Anthracenedione, 2,8-dihydroxy-1-methoxy-3-methyl-
- Anthraquinone, 2,8-dihydroxy-1-methoxy-3-methyl-
- Obtusifolin
- Obtusifolin (anthraquinone)
- Obtusifoline
Sort by
Found 7 products.
Obtusifolin
CAS:Obtusifolin is a natural compound, which is a bioactive anthraquinone derivative extracted from the seeds of Cassia obtusifolia, a plant known for its medicinal properties. With its unique molecular structure, Obtusifolin exhibits significant anti-inflammatory and antioxidant activities. These properties are primarily due to its ability to modulate various biochemical pathways, including the inhibition of pro-inflammatory cytokines and the scavenging of reactive oxygen species. In scientific research, Obtusifolin is utilized for its therapeutic potential in treating inflammatory conditions and oxidative stress-related disorders. Its applications extend to the exploration of its roles in neuroprotection, liver protection, and possible anticancer activities. As scientists continue to investigate its complex interactions within biological systems, Obtusifolin serves as a promising candidate in the development of future pharmacological interventions targeting inflammation and oxidative stress.Formula:C16H12O5Purity:Min. 95%Molecular weight:284.26 g/molObtusifolin
CAS:Obtusifolin is an antioxidant that combats diabetes, bone-resorption, diabetic retinopathy, pain, and cognitive decline.Formula:C16H12O5Purity:100% - 99.79%Color and Shape:SolidMolecular weight:284.26Ref: TM-T4S0969
1mg70.00€5mg187.00€10mg279.00€25mg472.00€50mg658.00€100mg933.00€1mL*10mM (DMSO)187.00€
