CAS 482-83-7: Dalbergin
Formula:C16H12O4
InChI:InChI=1S/C16H12O4/c1-19-15-9-14-12(7-13(15)17)11(8-16(18)20-14)10-5-3-2-4-6-10/h2-9,17H,1H3
InChI key:InChIKey=AZELSOYQOIUPBZ-UHFFFAOYSA-N
SMILES:OC=1C=C2C(=CC(=O)OC2=CC1OC)C3=CC=CC=C3
Synonyms:- 2H-1-benzopyran-2-one, 6-hydroxy-7-methoxy-4-phenyl-
- 6-Hydroxy-7-methoxy-4-phenyl-2H-1-benzopyran-2-one
- 6-Hydroxy-7-methoxy-4-phenyl-2H-chromen-2-on
- 6-Hydroxy-7-methoxy-4-phenylcoumarin
- Coumarin, 6-hydroxy-7-methoxy-4-phenyl-
- Dalbergin
- Dalbergione
- 6-Hydroxy-7-méthoxy-4-phényl-2H-chromén-2-one
Sort by
Found 8 products.
6-Hydroxy-7-methoxy-4-phenylcoumarin
CAS:6-Hydroxy-7-methoxy-4-phenylcoumarin is a synthetic chemical compound classified as a coumarin derivative. Derived from natural coumarin structures, this compound is often synthesized through organic chemistry techniques involving the hydroxylation and methoxylation of coumarin backbones, with the addition of a phenyl group. Its mode of action is primarily attributed to its potential interactions with various biological pathways, including enzyme inhibition or modulation of signaling cascades. The structural configuration allows it to engage in hydrogen bonding and pi-pi interactions, facilitating its activity within biological systems. Applications of 6-Hydroxy-7-methoxy-4-phenylcoumarin are primarily in biochemical research and pharmacological studies. It is investigated for its potential roles in modulating biological processes such as inflammation, oxidative stress, and cellular signaling pathways. Moreover, its structural backbone makes it a candidate for drug development research, exploring its efficacy and mechanism of action compared to similar coumarin-based compounds.Formula:C16H12O4Purity:Min. 95%Color and Shape:PowderMolecular weight:268.26 g/mol6-HYDROXY-7-METHOXY-4-PHENYLCOUMARIN
CAS:Formula:C16H12O4Purity:97%Color and Shape:SolidMolecular weight:268.2641Dalbergin
CAS:Dalbergin, a bone-conserving agent like estradiol, may treat postmenopausal osteoporosis and protects against skin photoaging.Formula:C16H12O4Purity:99.25%Color and Shape:SolidMolecular weight:268.26Dalbergin
CAS:Dalbergin analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C16H12O4Purity:(HPLC) ≥90%Color and Shape:PowderMolecular weight:268.28
