
CAS 482376-13-6: 4-(chloromethyl)-2-(4-fluorophenyl)pyridine
Formula:C12H9ClFN
InChI:InChI=1/C12H9ClFN/c13-8-9-5-6-15-12(7-9)10-1-3-11(14)4-2-10/h1-7H,8H2
SMILES:c1cc(ccc1c1cc(ccn1)CCl)F
Synonyms:- Pyridine, 4-(Chloromethyl)-2-(4-Fluorophenyl)-
- 4-(Chloromethyl)-2-(4-fluorophenyl)pyridine
Sort by
Found 1 products.
4-(Chloromethyl)-2-(4-Fluorophenyl)Pyridine
CAS:4-(Chloromethyl)-2-(4-fluorophenyl)pyridine is a compound that has been shown to have potential use in bladder cancer. It is currently under investigation and not yet approved for clinical use. This drug binds to the toll-like receptor 4 (TLR4) on cancer cells, which triggers a proinflammatory response. TLR4 activation induces the production of cytokines such as IL-6, IL-8, and TNF-α by tumor cells, leading to increased inflammation in the bladder. 4-(Chloromethyl)-2-(4-fluorophenyl)pyridine also inhibits muscle cell proliferation and causes malignant changes in bladder cells. The compound has been shown to be effective against muscle tissue, but not nonmuscle tissue.Formula:C12H9ClFNPurity:Min. 95%Molecular weight:221.66 g/mol