![5-methyl-1H-pyrrolo[3,2-b]pyridine](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F272336-5-methyl-1h-pyrrolo-32-b-pyridine.webp&w=3840&q=75)
CAS 4943-67-3: 5-methyl-1H-pyrrolo[3,2-b]pyridine
Formula:C8H8N2
InChI:InChI=1/C8H8N2/c1-6-2-3-7-8(10-6)4-5-9-7/h2-5,9H,1H3
SMILES:Cc1ccc2c(cc[nH]2)n1
Synonyms:- 1H-pyrrolo[3,2-b]pyridine, 5-methyl-
Sort by
Found 4 products.
5-Methyl-1H-pyrrolo[3,2-b]pyridine
CAS:5-Methyl-1H-pyrrolo[3,2-b]pyridine is a versatile compound that has various applications in different industries. It is commonly used in the production of polyvinyl and interferon, as well as in the synthesis of glycine and glutamate. This compound also finds its use in biomass production, where it acts as a catalyst for the growth of nanofibers. Additionally, 5-Methyl-1H-pyrrolo[3,2-b]pyridine has been studied for its potential therapeutic properties, including its ability to inhibit cytochalasin activity and the synthesis of oligosaccharides. Its unique chemical structure also makes it suitable for the development of copolymers and styrenic electrode materials. For research purposes or industrial applications, 5-Methyl-1H-pyrrolo[3,2-b]pyridine is a valuable compound with diverse uses. Its versatility and wide range of applicationsFormula:C8H8N2Purity:Min. 95%Molecular weight:132.16 g/mol5-METHYL-1H-PYRROLO[3,2-B]PYRIDINE
CAS:Formula:C8H8N2Purity:95%Color and Shape:SolidMolecular weight:132.16255-Methyl-1H-pyrrolo[3,2-b]pyridine
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:132.166000366210945-Methyl-1H-pyrrolo[3,2-b]pyridine
CAS:5-Methyl-1H-pyrrolo[3,2-b]pyridinePurity:95%Molecular weight:132.16g/mol