
CAS 49690-09-7: N-tert-butyl-4-nitrobenzenesulfonamide
Formula:C10H14N2O4S
InChI:InChI=1/C10H14N2O4S/c1-10(2,3)11-17(15,16)9-6-4-8(5-7-9)12(13)14/h4-7,11H,1-3H3
SMILES:CC(C)(C)NS(=O)(=O)c1ccc(cc1)N(=O)=O
Synonyms:- Benzenesulfonamide, N-(1,1-dimethylethyl)-4-nitro-
- N-tert-Butyl-4-nitro-benzenesulfonamide
Sort by
Found 4 products.
N-tert-Butyl 4-nitrophenylsulfonamide
CAS:N-tert-Butyl 4-nitrophenylsulfonamide is a versatile compound with various applications. It can be used as a research chemical in scientific studies or as an ingredient in the synthesis of other compounds. This compound has been found to exhibit antinociceptive properties, making it potentially useful in pain management. Additionally, N-tert-Butyl 4-nitrophenylsulfonamide can act as an electrode material and has been studied for its electrochemical properties. It reacts with certain chemicals such as dioscin, 5-hydroxymethylfurfural (5-HMF), and nicl2, forming new compounds with unique characteristics. Its carbonyl group allows for the formation of N-substituted carbamic acid derivatives, which have shown potential in various fields such as medicinal chemistry and materials science. With its wide range of applications and diverse reactivity, N-tert-Butyl 4-nitFormula:C10H14N2O4SPurity:Min. 95%Molecular weight:258.3 g/molN-tert-Butyl 4-Nitrophenylsulfonamide
CAS:Formula:C10H14N2O4SPurity:97%Color and Shape:SolidMolecular weight:258.2942N-Tert-Butyl 4-Nitrophenylsulfonamide
CAS:N-Tert-Butyl 4-NitrophenylsulfonamidePurity:98%+Molecular weight:258.07g/mol