
CAS 4971-18-0: 2-Ethylcyclopentanone
Formula:C7H12O
InChI:InChI=1S/C7H12O/c1-2-6-4-3-5-7(6)8/h6H,2-5H2,1H3
InChI key:InChIKey=PPTKUTYPOKHBTL-UHFFFAOYSA-N
SMILES:C(C)C1C(=O)CCC1
Synonyms:- 2-Ethylcyclopentanone
- Cyclopentanone, 2-ethyl-
- NSC 105441
- 2-Ethylcyclopentan-1-one
Sort by
Found 4 products.
2-Ethylcyclopentanone
CAS:2-Ethylcyclopentanone is an alicyclic compound that has been identified as an unidentified component in a variety of different samples. 2-Ethylcyclopentanone can be extracted using solid phase microextraction and analyzed by gas chromatography-mass spectrometry. The techniques used for the identification of 2-ethylcyclopentanone are similar to those used to identify fatty acids and inorganic acid isomers. The technique used to identify 2-ethylcyclopentanone depends on whether it is being considered as a fatty acid, an inorganic acid, or another type of molecule. If 2-ethylcyclopentanone is being considered as a fatty acid, then the technique used would be gas chromatography with flame ionization detection (GC/FID). If it is being considered an inorganic acid, then the technique would be gas chromatography with electron capture detection (GC/ECD). Finally, if it is being considered another type of molecule, thenFormula:C7H12OPurity:Min. 95%Molecular weight:112.17 g/molRef: 3D-FE123797
Discontinued product